C13H14N4O5 — CID 20929965
1-(3,4-dimethoxyphenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea (PubChem CID 20929965) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 20929965 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
| SMILES | COc1ccc(NC(=O)Nc2c[nH]c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C13H14N4O5/c1-21-9-4-3-7(5-10(9)22-2)15-13(20)16-8-6-14-12(19)17-11(8)18/h3-6H,1-2H3,(H2,15,16,20)(H2,14,17,18,19) |
| InChIKey | ZAARJHUWQLRJDW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |