C22H21ClFN3O2S — CID 20931151
N-(4-chloro-2-fluorophenyl)-1'-ethyl-2'-oxospiro[3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-5,3'-indole]-6-carboxamide (PubChem CID 20931151) has the molecular formula C22H21ClFN3O2S and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-1'-ethyl-2'-oxospiro[3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-5,3'-indole]-6-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-1'-ethyl-2'-oxospiro[3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-5,3'-indole]-6-carboxamide |
|---|---|
| PubChem CID | 20931151 |
| Molecular Formula | C22H21ClFN3O2S |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-1'-ethyl-2'-oxospiro[3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-5,3'-indole]-6-carboxamide |
| SMILES | CCN1C(=O)C2(c3ccccc31)C(C(=O)Nc1ccc(Cl)cc1F)CC1CSCN12 |
| InChI | InChI=1S/C22H21ClFN3O2S/c1-2-26-19-6-4-3-5-15(19)22(21(26)29)16(10-14-11-30-12-27(14)22)20(28)25-18-8-7-13(23)9-17(18)24/h3-9,14,16H,2,10-12H2,1H3,(H,25,28) |
| InChIKey | KFFDQOJBCOGZHN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |