C16H16ClN5O3 — CID 20931834
3-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 20931834) has the molecular formula C16H16ClN5O3 and a molecular weight of 361.79 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 20931834 |
| Molecular Formula | C16H16ClN5O3 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COCCNC(=O)c1nc(-c2cn(-c3ccc(Cl)cc3)nc2C)no1 |
| InChI | InChI=1S/C16H16ClN5O3/c1-10-13(9-22(20-10)12-5-3-11(17)4-6-12)14-19-16(25-21-14)15(23)18-7-8-24-2/h3-6,9H,7-8H2,1-2H3,(H,18,23) |
| InChIKey | FCMWDAISKVOHEP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|