C30H33ClN2O2S — CID 20932620
1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]indole (PubChem CID 20932620) has the molecular formula C30H33ClN2O2S and a molecular weight of 521.13 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]indole.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]indole |
|---|---|
| PubChem CID | 20932620 |
| Molecular Formula | C30H33ClN2O2S |
| Molecular Weight | 521.13 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]indole |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(c3c(C)n(Cc4ccc(Cl)cc4)c4ccccc34)CC2)c(C)c1 |
| InChI | InChI=1S/C30H33ClN2O2S/c1-20-17-21(2)30(22(3)18-20)36(34,35)32-15-13-25(14-16-32)29-23(4)33(28-8-6-5-7-27(28)29)19-24-9-11-26(31)12-10-24/h5-12,17-18,25H,13-16,19H2,1-4H3 |
| InChIKey | SLPLVHILPHEFSD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.13 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|