About 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide
2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide (PubChem CID 20933329) has the molecular formula C14H11BrN2O3S
and a molecular weight of 367.22 g/mol. Its IUPAC name is 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide |
| PubChem CID | 20933329 |
| Molecular Formula | C14H11BrN2O3S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide |
| SMILES | O=C1Cc2cc(NS(=O)(=O)c3ccccc3Br)ccc2N1 |
| InChI | InChI=1S/C14H11BrN2O3S/c15-11-3-1-2-4-13(11)21(19,20)17-10-5-6-12-9(7-10)8-14(18)16-12/h1-7,17H,8H2,(H,16,18) |
| InChIKey | USSSZRUFSHWPAL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide?
The IUPAC name of 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide (CID 20933329) is 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide.
What is the SMILES notation for 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide?
The canonical SMILES for 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide is O=C1Cc2cc(NS(=O)(=O)c3ccccc3Br)ccc2N1.
What is the InChIKey of 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide?
The InChIKey is USSSZRUFSHWPAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2O3S/c15-11-3-1-2-4-13(11)21(19,20)17-10-5-6-12-9(7-10)8-14(18)16-12/h1-7,17H,8H2,(H,16,18).
What are the key properties of 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide?
2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide has a molecular weight of 367.22 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide is sourced from PubChem (CID 20933329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).