C20H23F2N3O3S — CID 20933689
3,4-difluoro-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]benzamide (PubChem CID 20933689) has the molecular formula C20H23F2N3O3S and a molecular weight of 423.49 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]benzamide.
| Compound Name | 3,4-difluoro-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 20933689 |
| Molecular Formula | C20H23F2N3O3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3,4-difluoro-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCNC(=O)c3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H23F2N3O3S/c1-15-2-5-17(6-3-15)29(27,28)25-12-10-24(11-13-25)9-8-23-20(26)16-4-7-18(21)19(22)14-16/h2-7,14H,8-13H2,1H3,(H,23,26) |
| InChIKey | WWRGIERRPKFFBG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |