C19H19FN2O2S — CID 20933872
N-[(4-fluorophenyl)methyl]-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide (PubChem CID 20933872) has the molecular formula C19H19FN2O2S and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 20933872 |
| Molecular Formula | C19H19FN2O2S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide |
| SMILES | CC1=NC2c3c(oc(C(=O)NCc4ccc(F)cc4)c3C)CCC2S1 |
| InChI | InChI=1S/C19H19FN2O2S/c1-10-16-14(7-8-15-17(16)22-11(2)25-15)24-18(10)19(23)21-9-12-3-5-13(20)6-4-12/h3-6,15,17H,7-9H2,1-2H3,(H,21,23) |
| InChIKey | CWIJCQPLCSRWES-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |