C15H18N2O2S — CID 20933884
N-cyclopropyl-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide (PubChem CID 20933884) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-cyclopropyl-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide.
| Compound Name | N-cyclopropyl-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 20933884 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-cyclopropyl-2,8-dimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide |
| SMILES | CC1=NC2c3c(oc(C(=O)NC4CC4)c3C)CCC2S1 |
| InChI | InChI=1S/C15H18N2O2S/c1-7-12-10(5-6-11-13(12)16-8(2)20-11)19-14(7)15(18)17-9-3-4-9/h9,11,13H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | NFPJZWDGEYWPRU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |