C21H27N3O3S — CID 20934314
N-benzyl-3,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 20934314) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-benzyl-3,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | N-benzyl-3,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20934314 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-benzyl-3,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N2CCNCC2)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C21H27N3O3S/c1-17-8-9-20(14-18(17)2)28(26,27)24(15-19-6-4-3-5-7-19)16-21(25)23-12-10-22-11-13-23/h3-9,14,22H,10-13,15-16H2,1-2H3 |
| InChIKey | SUELPXIGBHALFL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |