C16H17F3N2O3S2 — CID 20935891
N-[2-(cyclohexen-1-yl)ethyl]-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide (PubChem CID 20935891) has the molecular formula C16H17F3N2O3S2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20935891 |
| Molecular Formula | C16H17F3N2O3S2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCC1=CCCCC1)c1ccc(-c2cc(C(F)(F)F)on2)s1 |
| InChI | InChI=1S/C16H17F3N2O3S2/c17-16(18,19)14-10-12(21-24-14)13-6-7-15(25-13)26(22,23)20-9-8-11-4-2-1-3-5-11/h4,6-7,10,20H,1-3,5,8-9H2 |
| InChIKey | QWQUUECTKBGTER-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|