C18H20N4O3 — CID 2093698
8-methyl-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2093698) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 8-methyl-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2093698 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 8-methyl-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(Cc1nc(-c3ccccc3)no1)C2=O |
| InChI | InChI=1S/C18H20N4O3/c1-12-7-9-18(10-8-12)16(23)22(17(24)20-18)11-14-19-15(21-25-14)13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3,(H,20,24) |
| InChIKey | SOXUDRNGHHCLQK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|