C15H22N4O2S2 — CID 20938165
N-[[1-(2-thiophen-2-ylethyl)piperidin-4-yl]methyl]-1H-imidazole-5-sulfonamide (PubChem CID 20938165) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[[1-(2-thiophen-2-ylethyl)piperidin-4-yl]methyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[[1-(2-thiophen-2-ylethyl)piperidin-4-yl]methyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 20938165 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[[1-(2-thiophen-2-ylethyl)piperidin-4-yl]methyl]-1H-imidazole-5-sulfonamide |
| SMILES | O=S(=O)(NCC1CCN(CCc2cccs2)CC1)c1cnc[nH]1 |
| InChI | InChI=1S/C15H22N4O2S2/c20-23(21,15-11-16-12-17-15)18-10-13-3-6-19(7-4-13)8-5-14-2-1-9-22-14/h1-2,9,11-13,18H,3-8,10H2,(H,16,17) |
| InChIKey | RVAXKYOXVBVBRZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |