C15H18N2O5S — CID 20938587
methyl 4-[(2-ethoxyphenyl)methylsulfamoyl]-1H-pyrrole-2-carboxylate (PubChem CID 20938587) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 4-[(2-ethoxyphenyl)methylsulfamoyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(2-ethoxyphenyl)methylsulfamoyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 20938587 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 4-[(2-ethoxyphenyl)methylsulfamoyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOc1ccccc1CNS(=O)(=O)c1c[nH]c(C(=O)OC)c1 |
| InChI | InChI=1S/C15H18N2O5S/c1-3-22-14-7-5-4-6-11(14)9-17-23(19,20)12-8-13(16-10-12)15(18)21-2/h4-8,10,16-17H,3,9H2,1-2H3 |
| InChIKey | FPFVUHPXCWJZLV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |