C13H16N2O5S — CID 20938619
methyl 4-[3-(furan-2-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylate (PubChem CID 20938619) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is methyl 4-[3-(furan-2-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[3-(furan-2-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 20938619 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methyl 4-[3-(furan-2-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCCc2ccco2)c[nH]1 |
| InChI | InChI=1S/C13H16N2O5S/c1-19-13(16)12-8-11(9-14-12)21(17,18)15-6-2-4-10-5-3-7-20-10/h3,5,7-9,14-15H,2,4,6H2,1H3 |
| InChIKey | KDSLYPGZYBWFCH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|