C15H16N4OS2 — CID 20938973
7-[(2-aminophenyl)sulfanylmethyl]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 20938973) has the molecular formula C15H16N4OS2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 7-[(2-aminophenyl)sulfanylmethyl]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[(2-aminophenyl)sulfanylmethyl]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 20938973 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 7-[(2-aminophenyl)sulfanylmethyl]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC(C)c1nn2c(=O)cc(CSc3ccccc3N)nc2s1 |
| InChI | InChI=1S/C15H16N4OS2/c1-9(2)14-18-19-13(20)7-10(17-15(19)22-14)8-21-12-6-4-3-5-11(12)16/h3-7,9H,8,16H2,1-2H3 |
| InChIKey | CUKMFDJCZNJALR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|