C15H17N5OS2 — CID 20939147
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 20939147) has the molecular formula C15H17N5OS2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 20939147 |
| Molecular Formula | C15H17N5OS2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | CCc1nc(SCc2cc(=O)n3c4c(sc3n2)CCCC4)n[nH]1 |
| InChI | InChI=1S/C15H17N5OS2/c1-2-12-17-14(19-18-12)22-8-9-7-13(21)20-10-5-3-4-6-11(10)23-15(20)16-9/h7H,2-6,8H2,1H3,(H,17,18,19) |
| InChIKey | AJIKBCKPKJZSEN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |