C23H27N3O2S2 — CID 20939290
2-ethyl-N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]butanamide (PubChem CID 20939290) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-ethyl-N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]butanamide.
| Compound Name | 2-ethyl-N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]butanamide |
|---|---|
| PubChem CID | 20939290 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-ethyl-N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccccc1SCc1cc(=O)n2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C23H27N3O2S2/c1-3-15(4-2)22(28)25-17-9-5-7-11-19(17)29-14-16-13-21(27)26-18-10-6-8-12-20(18)30-23(26)24-16/h5,7,9,11,13,15H,3-4,6,8,10,12,14H2,1-2H3,(H,25,28) |
| InChIKey | KRCWHZNYSZBMGW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |