C23H19N3O6S — CID 20939726
6-[[3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20939726) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is 6-[[3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20939726 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 6-[[3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | COc1ccc(CN2C(=O)c3cccnc3C2=O)cc1S(=O)(=O)N1CCOc2ccccc21 |
| InChI | InChI=1S/C23H19N3O6S/c1-31-19-9-8-15(14-25-22(27)16-5-4-10-24-21(16)23(25)28)13-20(19)33(29,30)26-11-12-32-18-7-3-2-6-17(18)26/h2-10,13H,11-12,14H2,1H3 |
| InChIKey | IPVIMXODZXLDKF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|