C23H19N3O3 — CID 20939884
N-benzyl-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]acetamide (PubChem CID 20939884) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-benzyl-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]acetamide.
| Compound Name | N-benzyl-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 20939884 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-benzyl-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1-c1nnc(-c2ccccc2)o1)NCc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c27-21(24-15-17-9-3-1-4-10-17)16-28-20-14-8-7-13-19(20)23-26-25-22(29-23)18-11-5-2-6-12-18/h1-14H,15-16H2,(H,24,27) |
| InChIKey | ACVKHABLHJKJMK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |