About 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide
1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide (PubChem CID 20940082) has the molecular formula C18H20N2OS
and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide |
| PubChem CID | 20940082 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)NCc3cccs3)ccc21 |
| InChI | InChI=1S/C18H20N2OS/c1-4-20-13(3)12(2)16-10-14(7-8-17(16)20)18(21)19-11-15-6-5-9-22-15/h5-10H,4,11H2,1-3H3,(H,19,21) |
| InChIKey | YSUAXHRAGAAUCB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide?
The IUPAC name of 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide (CID 20940082) is 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide.
What is the SMILES notation for 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide?
The canonical SMILES for 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide is CCn1c(C)c(C)c2cc(C(=O)NCc3cccs3)ccc21.
What is the InChIKey of 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide?
The InChIKey is YSUAXHRAGAAUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2OS/c1-4-20-13(3)12(2)16-10-14(7-8-17(16)20)18(21)19-11-15-6-5-9-22-15/h5-10H,4,11H2,1-3H3,(H,19,21).
What are the key properties of 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide?
1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide has a molecular weight of 312.44 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dimethyl-N-(thiophen-2-ylmethyl)indole-5-carboxamide is sourced from PubChem (CID 20940082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).