About (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone
(1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone (PubChem CID 20940110) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 20940110 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)N3CCCC3)ccc21 |
| InChI | InChI=1S/C17H22N2O/c1-4-19-13(3)12(2)15-11-14(7-8-16(15)19)17(20)18-9-5-6-10-18/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | IBVKZPYJAXUEPT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone?
The IUPAC name of (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone (CID 20940110) is (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone is CCn1c(C)c(C)c2cc(C(=O)N3CCCC3)ccc21.
What is the InChIKey of (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone?
The InChIKey is IBVKZPYJAXUEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-4-19-13(3)12(2)15-11-14(7-8-16(15)19)17(20)18-9-5-6-10-18/h7-8,11H,4-6,9-10H2,1-3H3.
What are the key properties of (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone?
(1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone has a molecular weight of 270.38 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-2,3-dimethylindol-5-yl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 20940110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).