C15H27N3 — CID 20941
2,4,6-tributyl-1,3,5-triazine (PubChem CID 20941) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2,4,6-tributyl-1,3,5-triazine.
| Compound Name | 2,4,6-tributyl-1,3,5-triazine |
|---|---|
| PubChem CID | 20941 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2,4,6-tributyl-1,3,5-triazine |
| SMILES | CCCCc1nc(CCCC)nc(CCCC)n1 |
| InChI | InChI=1S/C15H27N3/c1-4-7-10-13-16-14(11-8-5-2)18-15(17-13)12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | OPFJAODVGSZUDO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |