C20H18ClN3O3S — CID 20942006
N-(5-chloro-2-methylphenyl)-2-[4-(3-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide (PubChem CID 20942006) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[4-(3-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[4-(3-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 20942006 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[4-(3-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide |
| SMILES | COc1cccc(-n2ccnc(SCC(=O)Nc3cc(Cl)ccc3C)c2=O)c1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-13-6-7-14(21)10-17(13)23-18(25)12-28-19-20(26)24(9-8-22-19)15-4-3-5-16(11-15)27-2/h3-11H,12H2,1-2H3,(H,23,25) |
| InChIKey | UCZNPUVNIJEDKQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |