C13H17N5O4S — CID 20942786
N-(2-methoxyethyl)-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 20942786) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 20942786 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COCCNC(=O)c1cnc2sc(N3CCOCC3)nn2c1=O |
| InChI | InChI=1S/C13H17N5O4S/c1-21-5-2-14-10(19)9-8-15-12-18(11(9)20)16-13(23-12)17-3-6-22-7-4-17/h8H,2-7H2,1H3,(H,14,19) |
| InChIKey | NUGBIWVPDNKRMO-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|