C14H19N5O3S — CID 20942805
N-butyl-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 20942805) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-butyl-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | N-butyl-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 20942805 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-butyl-2-morpholin-4-yl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCCCNC(=O)c1cnc2sc(N3CCOCC3)nn2c1=O |
| InChI | InChI=1S/C14H19N5O3S/c1-2-3-4-15-11(20)10-9-16-13-19(12(10)21)17-14(23-13)18-5-7-22-8-6-18/h9H,2-8H2,1H3,(H,15,20) |
| InChIKey | AXRWLZCIUFEPGQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|