C24H20ClN3O3 — CID 20943891
N-(2-chlorophenyl)-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butanamide (PubChem CID 20943891) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butanamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 20943891 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butanamide |
| SMILES | CCC(Oc1ccccc1-c1nnc(-c2ccccc2)o1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H20ClN3O3/c1-2-20(22(29)26-19-14-8-7-13-18(19)25)30-21-15-9-6-12-17(21)24-28-27-23(31-24)16-10-4-3-5-11-16/h3-15,20H,2H2,1H3,(H,26,29) |
| InChIKey | FZIXJUJKAITZJO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |