C18H16N4O3S — CID 2094420
4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-7-methoxychromen-2-one (PubChem CID 2094420) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 2094420 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CSc3nc4nc(C)cc(C)n4n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H16N4O3S/c1-10-6-11(2)22-17(19-10)20-18(21-22)26-9-12-7-16(23)25-15-8-13(24-3)4-5-14(12)15/h4-8H,9H2,1-3H3 |
| InChIKey | MZUPQRLJIUUCQT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|