C24H28N4O5S — CID 20944522
N-(1,4-dimethyl-7-morpholin-4-yl-2,3-dioxoquinoxalin-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 20944522) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-(1,4-dimethyl-7-morpholin-4-yl-2,3-dioxoquinoxalin-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-(1,4-dimethyl-7-morpholin-4-yl-2,3-dioxoquinoxalin-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 20944522 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-(1,4-dimethyl-7-morpholin-4-yl-2,3-dioxoquinoxalin-6-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(N3CCOCC3)c(NS(=O)(=O)c3ccc4c(c3)CCCC4)cc21 |
| InChI | InChI=1S/C24H28N4O5S/c1-26-21-14-19(25-34(31,32)18-8-7-16-5-3-4-6-17(16)13-18)20(28-9-11-33-12-10-28)15-22(21)27(2)24(30)23(26)29/h7-8,13-15,25H,3-6,9-12H2,1-2H3 |
| InChIKey | HKFDPIBCGYGLOO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|