C20H21N3O3 — CID 20944533
3-phenyl-N-(1,4,7-trimethyl-2,3-dioxoquinoxalin-6-yl)propanamide (PubChem CID 20944533) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-phenyl-N-(1,4,7-trimethyl-2,3-dioxoquinoxalin-6-yl)propanamide.
| Compound Name | 3-phenyl-N-(1,4,7-trimethyl-2,3-dioxoquinoxalin-6-yl)propanamide |
|---|---|
| PubChem CID | 20944533 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-phenyl-N-(1,4,7-trimethyl-2,3-dioxoquinoxalin-6-yl)propanamide |
| SMILES | Cc1cc2c(cc1NC(=O)CCc1ccccc1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C20H21N3O3/c1-13-11-16-17(23(3)20(26)19(25)22(16)2)12-15(13)21-18(24)10-9-14-7-5-4-6-8-14/h4-8,11-12H,9-10H2,1-3H3,(H,21,24) |
| InChIKey | HZUHAXOSOVYPPM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|