About 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide
2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 20944881) has the molecular formula C20H23N3O4S2
and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 20944881 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(Cc1ccccc1)S(=O)(=O)c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-15-22-18-9-8-17(12-19(18)28-15)29(25,26)23(13-16-6-4-3-5-7-16)14-20(24)21-10-11-27-2/h3-9,12H,10-11,13-14H2,1-2H3,(H,21,24) |
| InChIKey | YAWLAYYCUOVRLF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide (CID 20944881) is 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide is COCCNC(=O)CN(Cc1ccccc1)S(=O)(=O)c1ccc2nc(C)sc2c1.
What is the InChIKey of 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide?
The InChIKey is YAWLAYYCUOVRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O4S2/c1-15-22-18-9-8-17(12-19(18)28-15)29(25,26)23(13-16-6-4-3-5-7-16)14-20(24)21-10-11-27-2/h3-9,12H,10-11,13-14H2,1-2H3,(H,21,24).
What are the key properties of 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide?
2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide has a molecular weight of 433.56 g/mol, XLogP of 2.56, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 20944881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).