C24H36N4O3S — CID 20945852
N-[3-(4-ethylpiperazin-1-yl)propyl]-3,7,7-trimethyl-5-oxo-8,9-dihydro-6H-carbazole-2-sulfonamide (PubChem CID 20945852) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-3,7,7-trimethyl-5-oxo-8,9-dihydro-6H-carbazole-2-sulfonamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-3,7,7-trimethyl-5-oxo-8,9-dihydro-6H-carbazole-2-sulfonamide |
|---|---|
| PubChem CID | 20945852 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-3,7,7-trimethyl-5-oxo-8,9-dihydro-6H-carbazole-2-sulfonamide |
| SMILES | CCN1CCN(CCCNS(=O)(=O)c2cc3[nH]c4c(c3cc2C)C(=O)CC(C)(C)C4)CC1 |
| InChI | InChI=1S/C24H36N4O3S/c1-5-27-9-11-28(12-10-27)8-6-7-25-32(30,31)22-14-19-18(13-17(22)2)23-20(26-19)15-24(3,4)16-21(23)29/h13-14,25-26H,5-12,15-16H2,1-4H3 |
| InChIKey | NJEISNCUBACNMA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|