C22H24N2O3S — CID 20945982
N-benzyl-N-ethyl-3-methyl-5-oxo-6,7,8,9-tetrahydrocarbazole-2-sulfonamide (PubChem CID 20945982) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-methyl-5-oxo-6,7,8,9-tetrahydrocarbazole-2-sulfonamide.
| Compound Name | N-benzyl-N-ethyl-3-methyl-5-oxo-6,7,8,9-tetrahydrocarbazole-2-sulfonamide |
|---|---|
| PubChem CID | 20945982 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-benzyl-N-ethyl-3-methyl-5-oxo-6,7,8,9-tetrahydrocarbazole-2-sulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1cc2[nH]c3c(c2cc1C)C(=O)CCC3 |
| InChI | InChI=1S/C22H24N2O3S/c1-3-24(14-16-8-5-4-6-9-16)28(26,27)21-13-19-17(12-15(21)2)22-18(23-19)10-7-11-20(22)25/h4-6,8-9,12-13,23H,3,7,10-11,14H2,1-2H3 |
| InChIKey | CDCWFPXYITZECK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |