About (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate (PubChem CID 20946485) has the molecular formula C15H18N2O3S
and a molecular weight of 306.39 g/mol. Its IUPAC name is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate |
| PubChem CID | 20946485 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate |
| SMILES | Cc1csc2nc(COC(=O)C3CCCCC3)cc(=O)n12 |
| InChI | InChI=1S/C15H18N2O3S/c1-10-9-21-15-16-12(7-13(18)17(10)15)8-20-14(19)11-5-3-2-4-6-11/h7,9,11H,2-6,8H2,1H3 |
| InChIKey | XFXMJQFGSGAWTG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate?
The IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate (CID 20946485) is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate.
What is the SMILES notation for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate?
The canonical SMILES for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate is Cc1csc2nc(COC(=O)C3CCCCC3)cc(=O)n12.
What is the InChIKey of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate?
The InChIKey is XFXMJQFGSGAWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S/c1-10-9-21-15-16-12(7-13(18)17(10)15)8-20-14(19)11-5-3-2-4-6-11/h7,9,11H,2-6,8H2,1H3.
What are the key properties of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate?
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate has a molecular weight of 306.39 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclohexanecarboxylate is sourced from PubChem (CID 20946485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).