About (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate
(2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate (PubChem CID 20946578) has the molecular formula C16H13FN2O5
and a molecular weight of 332.29 g/mol. Its IUPAC name is (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate.
Molecular Properties
| Compound Name | (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate |
| PubChem CID | 20946578 |
| Molecular Formula | C16H13FN2O5 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate |
| SMILES | Cc1cc2nc(COC(=O)COc3ccccc3F)cc(=O)n2o1 |
| InChI | InChI=1S/C16H13FN2O5/c1-10-6-14-18-11(7-15(20)19(14)24-10)8-23-16(21)9-22-13-5-3-2-4-12(13)17/h2-7H,8-9H2,1H3 |
| InChIKey | WFUZASQEJKOSSX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate?
The IUPAC name of (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate (CID 20946578) is (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate.
What is the SMILES notation for (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate?
The canonical SMILES for (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate is Cc1cc2nc(COC(=O)COc3ccccc3F)cc(=O)n2o1.
What is the InChIKey of (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate?
The InChIKey is WFUZASQEJKOSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O5/c1-10-6-14-18-11(7-15(20)19(14)24-10)8-23-16(21)9-22-13-5-3-2-4-12(13)17/h2-7H,8-9H2,1H3.
What are the key properties of (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate?
(2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate has a molecular weight of 332.29 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl 2-(2-fluorophenoxy)acetate is sourced from PubChem (CID 20946578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).