C17H16FN3O4S — CID 20946679
[2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methyl 2-fluorobenzoate (PubChem CID 20946679) has the molecular formula C17H16FN3O4S and a molecular weight of 377.40 g/mol. Its IUPAC name is [2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methyl 2-fluorobenzoate.
| Compound Name | [2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 20946679 |
| Molecular Formula | C17H16FN3O4S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methyl 2-fluorobenzoate |
| SMILES | CCOCCc1nn2c(=O)cc(COC(=O)c3ccccc3F)nc2s1 |
| InChI | InChI=1S/C17H16FN3O4S/c1-2-24-8-7-14-20-21-15(22)9-11(19-17(21)26-14)10-25-16(23)12-5-3-4-6-13(12)18/h3-6,9H,2,7-8,10H2,1H3 |
| InChIKey | KEZMHPNWZVGHFJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|