C12H17N3O2S2 — CID 20947418
N-tert-butyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide (PubChem CID 20947418) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-tert-butyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-tert-butyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20947418 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-tert-butyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)NC(C)(C)C)s2)n[nH]1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-8-7-9(14-13-8)10-5-6-11(18-10)19(16,17)15-12(2,3)4/h5-7,15H,1-4H3,(H,13,14) |
| InChIKey | VUGVPUMPDBHXAX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |