About 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine
1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine (PubChem CID 20947565) has the molecular formula C20H24N4O2S2
and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine.
Molecular Properties
| Compound Name | 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine |
| PubChem CID | 20947565 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine |
| SMILES | Cc1[nH]nc(-c2ccc(S(=O)(=O)N3CCN(Cc4ccccc4)CC3)s2)c1C |
| InChI | InChI=1S/C20H24N4O2S2/c1-15-16(2)21-22-20(15)18-8-9-19(27-18)28(25,26)24-12-10-23(11-13-24)14-17-6-4-3-5-7-17/h3-9H,10-14H2,1-2H3,(H,21,22) |
| InChIKey | GOANIMYXUDBOPO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine?
The IUPAC name of 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine (CID 20947565) is 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine.
What is the SMILES notation for 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine?
The canonical SMILES for 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine is Cc1[nH]nc(-c2ccc(S(=O)(=O)N3CCN(Cc4ccccc4)CC3)s2)c1C.
What is the InChIKey of 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine?
The InChIKey is GOANIMYXUDBOPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2S2/c1-15-16(2)21-22-20(15)18-8-9-19(27-18)28(25,26)24-12-10-23(11-13-24)14-17-6-4-3-5-7-17/h3-9H,10-14H2,1-2H3,(H,21,22).
What are the key properties of 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine?
1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine has a molecular weight of 416.57 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[5-(4,5-dimethyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine is sourced from PubChem (CID 20947565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).