About 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide
5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide (PubChem CID 20947603) has the molecular formula C15H15N3O2S2
and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide |
| PubChem CID | 20947603 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide |
| SMILES | Cc1[nH]nc(-c2ccc(S(=O)(=O)Nc3ccccc3)s2)c1C |
| InChI | InChI=1S/C15H15N3O2S2/c1-10-11(2)16-17-15(10)13-8-9-14(21-13)22(19,20)18-12-6-4-3-5-7-12/h3-9,18H,1-2H3,(H,16,17) |
| InChIKey | IQBGYNMJUOGCAN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide?
The IUPAC name of 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide (CID 20947603) is 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide.
What is the SMILES notation for 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide?
The canonical SMILES for 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide is Cc1[nH]nc(-c2ccc(S(=O)(=O)Nc3ccccc3)s2)c1C.
What is the InChIKey of 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide?
The InChIKey is IQBGYNMJUOGCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2S2/c1-10-11(2)16-17-15(10)13-8-9-14(21-13)22(19,20)18-12-6-4-3-5-7-12/h3-9,18H,1-2H3,(H,16,17).
What are the key properties of 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide?
5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide has a molecular weight of 333.44 g/mol, XLogP of 3.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-phenylthiophene-2-sulfonamide is sourced from PubChem (CID 20947603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).