About (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate
(2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate (PubChem CID 2094810) has the molecular formula C13H15NO5
and a molecular weight of 265.26 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate |
| PubChem CID | 2094810 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate |
| SMILES | O=C(OCC(=O)N1CCOCC1)c1ccccc1O |
| InChI | InChI=1S/C13H15NO5/c15-11-4-2-1-3-10(11)13(17)19-9-12(16)14-5-7-18-8-6-14/h1-4,15H,5-9H2 |
| InChIKey | JIKMGDWDTUACOM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate?
The IUPAC name of (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate (CID 2094810) is (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate.
What is the SMILES notation for (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate?
The canonical SMILES for (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate is O=C(OCC(=O)N1CCOCC1)c1ccccc1O.
What is the InChIKey of (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate?
The InChIKey is JIKMGDWDTUACOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c15-11-4-2-1-3-10(11)13(17)19-9-12(16)14-5-7-18-8-6-14/h1-4,15H,5-9H2.
What are the key properties of (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate?
(2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate has a molecular weight of 265.26 g/mol, XLogP of 0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-yl-2-oxoethyl) 2-hydroxybenzoate is sourced from PubChem (CID 2094810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).