About [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 2094846) has the molecular formula C16H11Cl2N3O4
and a molecular weight of 380.19 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
| PubChem CID | 2094846 |
| Molecular Formula | C16H11Cl2N3O4 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C1CN(C(=O)COC(=O)c2cnc(Cl)c(Cl)c2)c2ccccc2N1 |
| InChI | InChI=1S/C16H11Cl2N3O4/c17-10-5-9(6-19-15(10)18)16(24)25-8-14(23)21-7-13(22)20-11-3-1-2-4-12(11)21/h1-6H,7-8H2,(H,20,22) |
| InChIKey | JSWAJKWWJSQLID-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate?
The IUPAC name of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate (CID 2094846) is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate.
What is the SMILES notation for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate?
The canonical SMILES for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate is O=C1CN(C(=O)COC(=O)c2cnc(Cl)c(Cl)c2)c2ccccc2N1.
What is the InChIKey of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate?
The InChIKey is JSWAJKWWJSQLID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N3O4/c17-10-5-9(6-19-15(10)18)16(24)25-8-14(23)21-7-13(22)20-11-3-1-2-4-12(11)21/h1-6H,7-8H2,(H,20,22).
What are the key properties of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate?
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate has a molecular weight of 380.19 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate is sourced from PubChem (CID 2094846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).