About 2-propan-2-yloxyphenol
2-propan-2-yloxyphenol (PubChem CID 20949) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-propan-2-yloxyphenol.
Molecular Properties
| Compound Name | 2-propan-2-yloxyphenol |
| PubChem CID | 20949 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-propan-2-yloxyphenol |
| SMILES | CC(C)Oc1ccccc1O |
| InChI | InChI=1S/C9H12O2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,10H,1-2H3 |
| InChIKey | ZNCUUYCDKVNVJH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyphenol?
The IUPAC name of 2-propan-2-yloxyphenol (CID 20949) is 2-propan-2-yloxyphenol.
What is the SMILES notation for 2-propan-2-yloxyphenol?
The canonical SMILES for 2-propan-2-yloxyphenol is CC(C)Oc1ccccc1O.
What is the InChIKey of 2-propan-2-yloxyphenol?
The InChIKey is ZNCUUYCDKVNVJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,10H,1-2H3.
What are the key properties of 2-propan-2-yloxyphenol?
2-propan-2-yloxyphenol has a molecular weight of 152.19 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyphenol is sourced from PubChem (CID 20949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).