C26H31N3O3 — CID 20949232
N-cyclopentyl-N-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 20949232) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-cyclopentyl-N-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-cyclopentyl-N-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 20949232 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-cyclopentyl-N-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | CCN1CCCc2cc(CN(C(=O)Cn3c(=O)oc4ccccc43)C3CCCC3)ccc21 |
| InChI | InChI=1S/C26H31N3O3/c1-2-27-15-7-8-20-16-19(13-14-22(20)27)17-28(21-9-3-4-10-21)25(30)18-29-23-11-5-6-12-24(23)32-26(29)31/h5-6,11-14,16,21H,2-4,7-10,15,17-18H2,1H3 |
| InChIKey | XDTKKTMQVWNUFZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|