C21H23N3O3 — CID 20951008
1-[(1-benzylpyrrol-2-yl)methyl]-3-(2,5-dimethoxyphenyl)urea (PubChem CID 20951008) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[(1-benzylpyrrol-2-yl)methyl]-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-[(1-benzylpyrrol-2-yl)methyl]-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 20951008 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[(1-benzylpyrrol-2-yl)methyl]-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)NCc2cccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-26-18-10-11-20(27-2)19(13-18)23-21(25)22-14-17-9-6-12-24(17)15-16-7-4-3-5-8-16/h3-13H,14-15H2,1-2H3,(H2,22,23,25) |
| InChIKey | GUMDLEMOQUAMQD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |