C19H22N4O2S2 — CID 20952101
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide (PubChem CID 20952101) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20952101 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1ccco1)C1CCN(c2nc3cccnc3s2)CC1 |
| InChI | InChI=1S/C19H22N4O2S2/c24-17(20-8-12-26-13-15-3-2-11-25-15)14-5-9-23(10-6-14)19-22-16-4-1-7-21-18(16)27-19/h1-4,7,11,14H,5-6,8-10,12-13H2,(H,20,24) |
| InChIKey | KKTVNSJRGQRTDT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|