C21H26FN3O3S — CID 20952468
2-[6-[(4-fluorophenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 20952468) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[6-[(4-fluorophenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[6-[(4-fluorophenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 20952468 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[6-[(4-fluorophenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CN1CCCN(Cc2ccc(F)cc2)S1(=O)=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H26FN3O3S/c22-20-11-9-19(10-12-20)16-24-14-5-15-25(29(24,27)28)17-21(26)23-13-4-8-18-6-2-1-3-7-18/h1-3,6-7,9-12H,4-5,8,13-17H2,(H,23,26) |
| InChIKey | KUOFISWEZSPODQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|