C26H31N5O — CID 20953845
[1-(4-methylphenyl)-5-piperidin-4-ylpyrazol-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 20953845) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is [1-(4-methylphenyl)-5-piperidin-4-ylpyrazol-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [1-(4-methylphenyl)-5-piperidin-4-ylpyrazol-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 20953845 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [1-(4-methylphenyl)-5-piperidin-4-ylpyrazol-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(-n2ncc(C(=O)N3CCN(c4ccccc4)CC3)c2C2CCNCC2)cc1 |
| InChI | InChI=1S/C26H31N5O/c1-20-7-9-23(10-8-20)31-25(21-11-13-27-14-12-21)24(19-28-31)26(32)30-17-15-29(16-18-30)22-5-3-2-4-6-22/h2-10,19,21,27H,11-18H2,1H3 |
| InChIKey | CTVPYSATQSLDKL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |