About N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide
N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide (PubChem CID 20953937) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| PubChem CID | 20953937 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1[nH]nc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C17H19N3O/c21-17(18-12-6-2-3-7-12)16-14-10-9-11-5-1-4-8-13(11)15(14)19-20-16/h1,4-5,8,12H,2-3,6-7,9-10H2,(H,18,21)(H,19,20) |
| InChIKey | MTSOBMCVOZTUPU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide?
The IUPAC name of N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide (CID 20953937) is N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide.
What is the SMILES notation for N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide?
The canonical SMILES for N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide is O=C(NC1CCCC1)c1[nH]nc2c1CCc1ccccc1-2.
What is the InChIKey of N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide?
The InChIKey is MTSOBMCVOZTUPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O/c21-17(18-12-6-2-3-7-12)16-14-10-9-11-5-1-4-8-13(11)15(14)19-20-16/h1,4-5,8,12H,2-3,6-7,9-10H2,(H,18,21)(H,19,20).
What are the key properties of N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide?
N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide has a molecular weight of 281.36 g/mol, XLogP of 2.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide is sourced from PubChem (CID 20953937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).