About 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide
4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 20955370) has the molecular formula C16H28N4O4
and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide |
| PubChem CID | 20955370 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | COCCN1CCN(C2CCN(C(=O)NC(C)C)CC2)C(=O)C1=O |
| InChI | InChI=1S/C16H28N4O4/c1-12(2)17-16(23)19-6-4-13(5-7-19)20-9-8-18(10-11-24-3)14(21)15(20)22/h12-13H,4-11H2,1-3H3,(H,17,23) |
| InChIKey | RMFVTWYHOWIGFB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide?
The IUPAC name of 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide (CID 20955370) is 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide.
What is the SMILES notation for 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide?
The canonical SMILES for 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide is COCCN1CCN(C2CCN(C(=O)NC(C)C)CC2)C(=O)C1=O.
What is the InChIKey of 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide?
The InChIKey is RMFVTWYHOWIGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O4/c1-12(2)17-16(23)19-6-4-13(5-7-19)20-9-8-18(10-11-24-3)14(21)15(20)22/h12-13H,4-11H2,1-3H3,(H,17,23).
What are the key properties of 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide?
4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide has a molecular weight of 340.42 g/mol, XLogP of -0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]-N-propan-2-ylpiperidine-1-carboxamide is sourced from PubChem (CID 20955370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).