About 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one
3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one (PubChem CID 2095566) has the molecular formula C20H21N3OS
and a molecular weight of 351.48 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one |
| PubChem CID | 2095566 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CCc1nc2ccccc2s1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3OS/c24-20(11-10-19-21-17-8-4-5-9-18(17)25-19)23-14-12-22(13-15-23)16-6-2-1-3-7-16/h1-9H,10-15H2 |
| InChIKey | MKEFXQJTMUJROX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one (CID 2095566) is 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one is O=C(CCc1nc2ccccc2s1)N1CCN(c2ccccc2)CC1.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one?
The InChIKey is MKEFXQJTMUJROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3OS/c24-20(11-10-19-21-17-8-4-5-9-18(17)25-19)23-14-12-22(13-15-23)16-6-2-1-3-7-16/h1-9H,10-15H2.
What are the key properties of 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one?
3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one has a molecular weight of 351.48 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)propan-1-one is sourced from PubChem (CID 2095566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).