About 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid
2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid (PubChem CID 20955814) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid |
| PubChem CID | 20955814 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1CCN(C)C(=O)C1=O |
| InChI | InChI=1S/C9H14N2O4/c1-3-6(9(14)15)11-5-4-10(2)7(12)8(11)13/h6H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | DCTLQHKAYGJQTL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid?
The IUPAC name of 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid (CID 20955814) is 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid.
What is the SMILES notation for 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid?
The canonical SMILES for 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid is CCC(C(=O)O)N1CCN(C)C(=O)C1=O.
What is the InChIKey of 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid?
The InChIKey is DCTLQHKAYGJQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-3-6(9(14)15)11-5-4-10(2)7(12)8(11)13/h6H,3-5H2,1-2H3,(H,14,15).
What are the key properties of 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid?
2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid has a molecular weight of 214.22 g/mol, XLogP of -0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2,3-dioxopiperazin-1-yl)butanoic acid is sourced from PubChem (CID 20955814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).